C12H20N2 — CID 142930893
1-N,1-N-diethyl-3-N,4-dimethylbenzene-1,3-diamine (PubChem CID 142930893) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-N,1-N-diethyl-3-N,4-dimethylbenzene-1,3-diamine.
| Compound Name | 1-N,1-N-diethyl-3-N,4-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 142930893 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-N,1-N-diethyl-3-N,4-dimethylbenzene-1,3-diamine |
| SMILES | CCN(CC)c1ccc(C)c(NC)c1 |
| InChI | InChI=1S/C12H20N2/c1-5-14(6-2)11-8-7-10(3)12(9-11)13-4/h7-9,13H,5-6H2,1-4H3 |
| InChIKey | FRBAXMJYZFWZLY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |