C13H20F2N2O2S — CID 147931901
N-[5-(diethylamino)-2-methylphenyl]-2,2-difluoroethanesulfonamide (PubChem CID 147931901) has the molecular formula C13H20F2N2O2S and a molecular weight of 306.38 g/mol. Its IUPAC name is N-[5-(diethylamino)-2-methylphenyl]-2,2-difluoroethanesulfonamide.
| Compound Name | N-[5-(diethylamino)-2-methylphenyl]-2,2-difluoroethanesulfonamide |
|---|---|
| PubChem CID | 147931901 |
| Molecular Formula | C13H20F2N2O2S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[5-(diethylamino)-2-methylphenyl]-2,2-difluoroethanesulfonamide |
| SMILES | CCN(CC)c1ccc(C)c(NS(=O)(=O)CC(F)F)c1 |
| InChI | InChI=1S/C13H20F2N2O2S/c1-4-17(5-2)11-7-6-10(3)12(8-11)16-20(18,19)9-13(14)15/h6-8,13,16H,4-5,9H2,1-3H3 |
| InChIKey | IKANXKUHOMTJIO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |