C33H48AsN3 — CID 91746010
4-bis[4-(diethylamino)-2-methylphenyl]arsanyl-N,N-diethyl-3-methylaniline (PubChem CID 91746010) has the molecular formula C33H48AsN3 and a molecular weight of 561.69 g/mol. Its IUPAC name is 4-bis[4-(diethylamino)-2-methylphenyl]arsanyl-N,N-diethyl-3-methylaniline.
| Compound Name | 4-bis[4-(diethylamino)-2-methylphenyl]arsanyl-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 91746010 |
| Molecular Formula | C33H48AsN3 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 4-bis[4-(diethylamino)-2-methylphenyl]arsanyl-N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1ccc([As](c2ccc(N(CC)CC)cc2C)c2ccc(N(CC)CC)cc2C)c(C)c1 |
| InChI | InChI=1S/C33H48AsN3/c1-10-35(11-2)28-16-19-31(25(7)22-28)34(32-20-17-29(23-26(32)8)36(12-3)13-4)33-21-18-30(24-27(33)9)37(14-5)15-6/h16-24H,10-15H2,1-9H3 |
| InChIKey | DMFGVTZEHIUCTH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|