C30H42AsN3 — CID 21439568
4-bis[4-(diethylamino)phenyl]arsanyl-N,N-diethylaniline (PubChem CID 21439568) has the molecular formula C30H42AsN3 and a molecular weight of 519.61 g/mol. Its IUPAC name is 4-bis[4-(diethylamino)phenyl]arsanyl-N,N-diethylaniline.
| Compound Name | 4-bis[4-(diethylamino)phenyl]arsanyl-N,N-diethylaniline |
|---|---|
| PubChem CID | 21439568 |
| Molecular Formula | C30H42AsN3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 4-bis[4-(diethylamino)phenyl]arsanyl-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc([As](c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C30H42AsN3/c1-7-32(8-2)28-19-13-25(14-20-28)31(26-15-21-29(22-16-26)33(9-3)10-4)27-17-23-30(24-18-27)34(11-5)12-6/h13-24H,7-12H2,1-6H3 |
| InChIKey | CPCCHIUOTPLUEO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|