C18H31N3O — CID 109031413
N-tert-butyl-3-[4-(diethylamino)-2-methylanilino]propanamide (PubChem CID 109031413) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is N-tert-butyl-3-[4-(diethylamino)-2-methylanilino]propanamide.
| Compound Name | N-tert-butyl-3-[4-(diethylamino)-2-methylanilino]propanamide |
|---|---|
| PubChem CID | 109031413 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | N-tert-butyl-3-[4-(diethylamino)-2-methylanilino]propanamide |
| SMILES | CCN(CC)c1ccc(NCCC(=O)NC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H31N3O/c1-7-21(8-2)15-9-10-16(14(3)13-15)19-12-11-17(22)20-18(4,5)6/h9-10,13,19H,7-8,11-12H2,1-6H3,(H,20,22) |
| InChIKey | VBDPOICPCDOGDY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|