C21H34N4O3 — CID 109029114
ethyl 4-[3-[4-(diethylamino)-2-methylanilino]propanoyl]piperazine-1-carboxylate (PubChem CID 109029114) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is ethyl 4-[3-[4-(diethylamino)-2-methylanilino]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[4-(diethylamino)-2-methylanilino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109029114 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | ethyl 4-[3-[4-(diethylamino)-2-methylanilino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCNc2ccc(N(CC)CC)cc2C)CC1 |
| InChI | InChI=1S/C21H34N4O3/c1-5-23(6-2)18-8-9-19(17(4)16-18)22-11-10-20(26)24-12-14-25(15-13-24)21(27)28-7-3/h8-9,16,22H,5-7,10-15H2,1-4H3 |
| InChIKey | VBTMNCXFHUIQET-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|