C23H23N3 — CID 27795
3-N,3-N,6-N,6-N-tetramethyl-9-phenylacridine-3,6-diamine (PubChem CID 27795) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is 3-N,3-N,6-N,6-N-tetramethyl-9-phenylacridine-3,6-diamine.
| Compound Name | 3-N,3-N,6-N,6-N-tetramethyl-9-phenylacridine-3,6-diamine |
|---|---|
| PubChem CID | 27795 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3-N,3-N,6-N,6-N-tetramethyl-9-phenylacridine-3,6-diamine |
| SMILES | CN(C)c1ccc2c(-c3ccccc3)c3ccc(N(C)C)cc3nc2c1 |
| InChI | InChI=1S/C23H23N3/c1-25(2)17-10-12-19-21(14-17)24-22-15-18(26(3)4)11-13-20(22)23(19)16-8-6-5-7-9-16/h5-15H,1-4H3 |
| InChIKey | HIAMHAJROFCFGD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|