C23H23ClN2S — CID 87331561
2-N,2-N,7-N,7-N-tetramethyl-9-phenylthioxanthen-10-ium-2,7-diamine chloride (PubChem CID 87331561) has the molecular formula C23H23ClN2S and a molecular weight of 394.97 g/mol. Its IUPAC name is 2-N,2-N,7-N,7-N-tetramethyl-9-phenylthioxanthen-10-ium-2,7-diamine chloride.
| Compound Name | 2-N,2-N,7-N,7-N-tetramethyl-9-phenylthioxanthen-10-ium-2,7-diamine chloride |
|---|---|
| PubChem CID | 87331561 |
| Molecular Formula | C23H23ClN2S |
| Molecular Weight | 394.97 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-N,2-N,7-N,7-N-tetramethyl-9-phenylthioxanthen-10-ium-2,7-diamine chloride |
| SMILES | CN(C)c1ccc2[s+]c3ccc(N(C)C)cc3c(-c3ccccc3)c2c1.[Cl-] |
| InChI | InChI=1S/C23H23N2S.ClH/c1-24(2)17-10-12-21-19(14-17)23(16-8-6-5-7-9-16)20-15-18(25(3)4)11-13-22(20)26-21;/h5-15H,1-4H3;1H/q+1;/p-1 |
| InChIKey | XZXIJMIQGSOGOZ-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.97 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|