C14H16N2 — CID 18371357
4-N,4-N-dimethyl-2-phenylbenzene-1,4-diamine (PubChem CID 18371357) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-phenylbenzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-2-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 18371357 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-N,4-N-dimethyl-2-phenylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(N)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H16N2/c1-16(2)12-8-9-14(15)13(10-12)11-6-4-3-5-7-11/h3-10H,15H2,1-2H3 |
| InChIKey | IQQGOJZFTZOCPC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|