C15H19FN2 — CID 22288747
N,N-dimethylmethanamine;2-fluoro-4-phenylaniline (PubChem CID 22288747) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-fluoro-4-phenylaniline.
| Compound Name | N,N-dimethylmethanamine;2-fluoro-4-phenylaniline |
|---|---|
| PubChem CID | 22288747 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N,N-dimethylmethanamine;2-fluoro-4-phenylaniline |
| SMILES | CN(C)C.Nc1ccc(-c2ccccc2)cc1F |
| InChI | InChI=1S/C12H10FN.C3H9N/c13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9;1-4(2)3/h1-8H,14H2;1-3H3 |
| InChIKey | OZYFUOZPFSYCRV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|