C18H13F2N — CID 107615842
2,5-difluoro-4-(4-phenylphenyl)aniline (PubChem CID 107615842) has the molecular formula C18H13F2N and a molecular weight of 281.31 g/mol. Its IUPAC name is 2,5-difluoro-4-(4-phenylphenyl)aniline.
| Compound Name | 2,5-difluoro-4-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 107615842 |
| Molecular Formula | C18H13F2N |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2,5-difluoro-4-(4-phenylphenyl)aniline |
| SMILES | Nc1cc(F)c(-c2ccc(-c3ccccc3)cc2)cc1F |
| InChI | InChI=1S/C18H13F2N/c19-16-11-18(21)17(20)10-15(16)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H,21H2 |
| InChIKey | RCUSLBHHDGALAU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|