C22H25N — CID 141067030
N,N-dimethyl-3-phenyl-4-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)aniline (PubChem CID 141067030) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is N,N-dimethyl-3-phenyl-4-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)aniline.
| Compound Name | N,N-dimethyl-3-phenyl-4-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)aniline |
|---|---|
| PubChem CID | 141067030 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | N,N-dimethyl-3-phenyl-4-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)aniline |
| SMILES | CC1=C(C)C(C)=C(c2ccc(N(C)C)cc2-c2ccccc2)C1 |
| InChI | InChI=1S/C22H25N/c1-15-13-21(17(3)16(15)2)20-12-11-19(23(4)5)14-22(20)18-9-7-6-8-10-18/h6-12,14H,13H2,1-5H3 |
| InChIKey | RQJBIUHKNNMPRE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|