C27H27OP — CID 139996353
[5-methoxy-2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)phenyl]-diphenylphosphane (PubChem CID 139996353) has the molecular formula C27H27OP and a molecular weight of 398.49 g/mol. Its IUPAC name is [5-methoxy-2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)phenyl]-diphenylphosphane.
| Compound Name | [5-methoxy-2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 139996353 |
| Molecular Formula | C27H27OP |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [5-methoxy-2-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)phenyl]-diphenylphosphane |
| SMILES | COc1ccc(C2=C(C)C(C)=C(C)C2)c(P(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H27OP/c1-19-17-26(21(3)20(19)2)25-16-15-22(28-4)18-27(25)29(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-16,18H,17H2,1-4H3 |
| InChIKey | JOIIPSXDNNALCV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|