C23H24N2 — CID 175462005
6-N-ethyl-2-N,2-N-dimethyl-6-N-phenyl-9H-fluorene-2,6-diamine (PubChem CID 175462005) has the molecular formula C23H24N2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 6-N-ethyl-2-N,2-N-dimethyl-6-N-phenyl-9H-fluorene-2,6-diamine.
| Compound Name | 6-N-ethyl-2-N,2-N-dimethyl-6-N-phenyl-9H-fluorene-2,6-diamine |
|---|---|
| PubChem CID | 175462005 |
| Molecular Formula | C23H24N2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 6-N-ethyl-2-N,2-N-dimethyl-6-N-phenyl-9H-fluorene-2,6-diamine |
| SMILES | CCN(c1ccccc1)c1ccc2c(c1)-c1ccc(N(C)C)cc1C2 |
| InChI | InChI=1S/C23H24N2/c1-4-25(19-8-6-5-7-9-19)21-11-10-17-14-18-15-20(24(2)3)12-13-22(18)23(17)16-21/h5-13,15-16H,4,14H2,1-3H3 |
| InChIKey | CCAUZSNMTCTOLX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |