About benzo[a]oxanthren-10-ylboronic acid;ethane
benzo[a]oxanthren-10-ylboronic acid;ethane (PubChem CID 142294193) has the molecular formula C20H23BO4
and a molecular weight of 338.21 g/mol. Its IUPAC name is benzo[a]oxanthren-10-ylboronic acid;ethane.
Molecular Properties
| Compound Name | benzo[a]oxanthren-10-ylboronic acid;ethane |
| PubChem CID | 142294193 |
| Molecular Formula | C20H23BO4 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | benzo[a]oxanthren-10-ylboronic acid;ethane |
| SMILES | CC.CC.OB(O)c1ccc2c(c1)Oc1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C16H11BO4.2C2H6/c18-17(19)11-6-8-13-15(9-11)21-16-12-4-2-1-3-10(12)5-7-14(16)20-13;2*1-2/h1-9,18-19H;2*1-2H3 |
| InChIKey | XQXWOTROPZJSAC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzo[a]oxanthren-10-ylboronic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[a]oxanthren-10-ylboronic acid;ethane?
The IUPAC name of benzo[a]oxanthren-10-ylboronic acid;ethane (CID 142294193) is benzo[a]oxanthren-10-ylboronic acid;ethane.
What is the SMILES notation for benzo[a]oxanthren-10-ylboronic acid;ethane?
The canonical SMILES for benzo[a]oxanthren-10-ylboronic acid;ethane is CC.CC.OB(O)c1ccc2c(c1)Oc1c(ccc3ccccc13)O2.
What is the InChIKey of benzo[a]oxanthren-10-ylboronic acid;ethane?
The InChIKey is XQXWOTROPZJSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BO4.2C2H6/c18-17(19)11-6-8-13-15(9-11)21-16-12-4-2-1-3-10(12)5-7-14(16)20-13;2*1-2/h1-9,18-19H;2*1-2H3.
What are the key properties of benzo[a]oxanthren-10-ylboronic acid;ethane?
benzo[a]oxanthren-10-ylboronic acid;ethane has a molecular weight of 338.21 g/mol, XLogP of 4.47, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[a]oxanthren-10-ylboronic acid;ethane is sourced from PubChem (CID 142294193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).