C10H7NO4 — CID 117293081
2-(3-methyl-1,2-benzoxazol-5-yl)-2-oxoacetic acid (PubChem CID 117293081) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 2-(3-methyl-1,2-benzoxazol-5-yl)-2-oxoacetic acid.
| Compound Name | 2-(3-methyl-1,2-benzoxazol-5-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117293081 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-(3-methyl-1,2-benzoxazol-5-yl)-2-oxoacetic acid |
| SMILES | Cc1noc2ccc(C(=O)C(=O)O)cc12 |
| InChI | InChI=1S/C10H7NO4/c1-5-7-4-6(9(12)10(13)14)2-3-8(7)15-11-5/h2-4H,1H3,(H,13,14) |
| InChIKey | QSEVIDOIOXAZQF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|