C11H10FNO3 — CID 84688135
3-(2-fluoropropan-2-yl)-1,2-benzoxazole-5-carboxylic acid (PubChem CID 84688135) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is 3-(2-fluoropropan-2-yl)-1,2-benzoxazole-5-carboxylic acid.
| Compound Name | 3-(2-fluoropropan-2-yl)-1,2-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 84688135 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 3-(2-fluoropropan-2-yl)-1,2-benzoxazole-5-carboxylic acid |
| SMILES | CC(C)(F)c1noc2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C11H10FNO3/c1-11(2,12)9-7-5-6(10(14)15)3-4-8(7)16-13-9/h3-5H,1-2H3,(H,14,15) |
| InChIKey | LDXMPEYAHWXARR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |