3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid

C9H6FNO3 — CID 84665859

IUPAC3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid
SMILESO=C(O)c1ccc2c(CF)noc2c1
InChIInChI=1S/C9H6FNO3/c10-4-7-6-2-1-5(9(12)13)3-8(6)14-11-7/h1-3H,4H2,(H,12,13)
InChIKeyGZTZOUKAMPZSLU-UHFFFAOYSA-N
MW195.15 g/mol
LogP2.00
Rot. Bonds2

About 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid

3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid (PubChem CID 84665859) has the molecular formula C9H6FNO3 and a molecular weight of 195.15 g/mol. Its IUPAC name is 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid.

Molecular Properties

Compound Name3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid
PubChem CID84665859
Molecular FormulaC9H6FNO3
Molecular Weight195.15 g/mol
Exact Mass195.03
IUPAC Name3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid
SMILESO=C(O)c1ccc2c(CF)noc2c1
InChIInChI=1S/C9H6FNO3/c10-4-7-6-2-1-5(9(12)13)3-8(6)14-11-7/h1-3H,4H2,(H,12,13)
InChIKeyGZTZOUKAMPZSLU-UHFFFAOYSA-N
XLogP2.00
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.15
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid?
The IUPAC name of 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid (CID 84665859) is 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid.
What is the SMILES notation for 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid?
The canonical SMILES for 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid is O=C(O)c1ccc2c(CF)noc2c1.
What is the InChIKey of 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid?
The InChIKey is GZTZOUKAMPZSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO3/c10-4-7-6-2-1-5(9(12)13)3-8(6)14-11-7/h1-3H,4H2,(H,12,13).
What are the key properties of 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid?
3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid has a molecular weight of 195.15 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(fluoromethyl)-1,2-benzoxazole-6-carboxylic acid is sourced from PubChem (CID 84665859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).