(3-acetamido-1,2-benzoxazol-6-yl)boronic acid

C9H9BN2O4 — CID 59410615

IUPAC(3-acetamido-1,2-benzoxazol-6-yl)boronic acid
SMILESCC(=O)Nc1noc2cc(B(O)O)ccc12
InChIInChI=1S/C9H9BN2O4/c1-5(13)11-9-7-3-2-6(10(14)15)4-8(7)16-12-9/h2-4,14-15H,1H3,(H,11,12,13)
InChIKeyVRZCIVANSINLBC-UHFFFAOYSA-N
MW219.99 g/mol
LogP-0.53
Rot. Bonds2

About (3-acetamido-1,2-benzoxazol-6-yl)boronic acid

(3-acetamido-1,2-benzoxazol-6-yl)boronic acid (PubChem CID 59410615) has the molecular formula C9H9BN2O4 and a molecular weight of 219.99 g/mol. Its IUPAC name is (3-acetamido-1,2-benzoxazol-6-yl)boronic acid.

Molecular Properties

Compound Name(3-acetamido-1,2-benzoxazol-6-yl)boronic acid
PubChem CID59410615
Molecular FormulaC9H9BN2O4
Molecular Weight219.99 g/mol
Exact Mass220.07
IUPAC Name(3-acetamido-1,2-benzoxazol-6-yl)boronic acid
SMILESCC(=O)Nc1noc2cc(B(O)O)ccc12
InChIInChI=1S/C9H9BN2O4/c1-5(13)11-9-7-3-2-6(10(14)15)4-8(7)16-12-9/h2-4,14-15H,1H3,(H,11,12,13)
InChIKeyVRZCIVANSINLBC-UHFFFAOYSA-N
XLogP-0.53
TPSA95.59 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.99
LogP ≤ 5-0.53
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3-acetamido-1,2-benzoxazol-6-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-acetamido-1,2-benzoxazol-6-yl)boronic acid?
The IUPAC name of (3-acetamido-1,2-benzoxazol-6-yl)boronic acid (CID 59410615) is (3-acetamido-1,2-benzoxazol-6-yl)boronic acid.
What is the SMILES notation for (3-acetamido-1,2-benzoxazol-6-yl)boronic acid?
The canonical SMILES for (3-acetamido-1,2-benzoxazol-6-yl)boronic acid is CC(=O)Nc1noc2cc(B(O)O)ccc12.
What is the InChIKey of (3-acetamido-1,2-benzoxazol-6-yl)boronic acid?
The InChIKey is VRZCIVANSINLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BN2O4/c1-5(13)11-9-7-3-2-6(10(14)15)4-8(7)16-12-9/h2-4,14-15H,1H3,(H,11,12,13).
What are the key properties of (3-acetamido-1,2-benzoxazol-6-yl)boronic acid?
(3-acetamido-1,2-benzoxazol-6-yl)boronic acid has a molecular weight of 219.99 g/mol, XLogP of -0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetamido-1,2-benzoxazol-6-yl)boronic acid is sourced from PubChem (CID 59410615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).