C10H9ClN2O2 — CID 119084323
N-[3-(chloromethyl)-1,2-benzoxazol-6-yl]acetamide (PubChem CID 119084323) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is N-[3-(chloromethyl)-1,2-benzoxazol-6-yl]acetamide.
| Compound Name | N-[3-(chloromethyl)-1,2-benzoxazol-6-yl]acetamide |
|---|---|
| PubChem CID | 119084323 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | N-[3-(chloromethyl)-1,2-benzoxazol-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(CCl)noc2c1 |
| InChI | InChI=1S/C10H9ClN2O2/c1-6(14)12-7-2-3-8-9(5-11)13-15-10(8)4-7/h2-4H,5H2,1H3,(H,12,14) |
| InChIKey | PXQCMTOJUJVUQI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|