C11H11NO3 — CID 15563065
(3-ethyl-1,2-benzoxazol-6-yl) acetate (PubChem CID 15563065) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is (3-ethyl-1,2-benzoxazol-6-yl) acetate.
| Compound Name | (3-ethyl-1,2-benzoxazol-6-yl) acetate |
|---|---|
| PubChem CID | 15563065 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (3-ethyl-1,2-benzoxazol-6-yl) acetate |
| SMILES | CCc1noc2cc(OC(C)=O)ccc12 |
| InChI | InChI=1S/C11H11NO3/c1-3-10-9-5-4-8(14-7(2)13)6-11(9)15-12-10/h4-6H,3H2,1-2H3 |
| InChIKey | NOPRGFZVRWXFNQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|