About [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate
[3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate (PubChem CID 29137223) has the molecular formula C19H12FNO4
and a molecular weight of 337.31 g/mol. Its IUPAC name is [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate |
| PubChem CID | 29137223 |
| Molecular Formula | C19H12FNO4 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccc2c(Cc3ccccc3F)noc2c1)c1ccco1 |
| InChI | InChI=1S/C19H12FNO4/c20-15-5-2-1-4-12(15)10-16-14-8-7-13(11-18(14)25-21-16)24-19(22)17-6-3-9-23-17/h1-9,11H,10H2 |
| InChIKey | RWLHDPZYMVEIRT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate?
The IUPAC name of [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate (CID 29137223) is [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate.
What is the SMILES notation for [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate?
The canonical SMILES for [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate is O=C(Oc1ccc2c(Cc3ccccc3F)noc2c1)c1ccco1.
What is the InChIKey of [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate?
The InChIKey is RWLHDPZYMVEIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12FNO4/c20-15-5-2-1-4-12(15)10-16-14-8-7-13(11-18(14)25-21-16)24-19(22)17-6-3-9-23-17/h1-9,11H,10H2.
What are the key properties of [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate?
[3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate has a molecular weight of 337.31 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2-fluorophenyl)methyl]-1,2-benzoxazol-6-yl] furan-2-carboxylate is sourced from PubChem (CID 29137223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).