C11H10ClN3O2 — CID 21358511
N-[3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide (PubChem CID 21358511) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is N-[3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide.
| Compound Name | N-[3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 21358511 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | N-[3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2noc(CCl)n2)c1 |
| InChI | InChI=1S/C11H10ClN3O2/c1-7(16)13-9-4-2-3-8(5-9)11-14-10(6-12)17-15-11/h2-5H,6H2,1H3,(H,13,16) |
| InChIKey | GZUQAPKMUFEFHQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|