C14H18N4O2 — CID 54073306
1,1-dimethyl-3-[3-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]urea (PubChem CID 54073306) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1,1-dimethyl-3-[3-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]urea.
| Compound Name | 1,1-dimethyl-3-[3-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 54073306 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1,1-dimethyl-3-[3-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]urea |
| SMILES | CCCc1nc(-c2cccc(NC(=O)N(C)C)c2)no1 |
| InChI | InChI=1S/C14H18N4O2/c1-4-6-12-16-13(17-20-12)10-7-5-8-11(9-10)15-14(19)18(2)3/h5,7-9H,4,6H2,1-3H3,(H,15,19) |
| InChIKey | MHZDUPDYRUEKSV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |