C10H12KNO — CID 169219888
potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide (PubChem CID 169219888) has the molecular formula C10H12KNO and a molecular weight of 201.31 g/mol. Its IUPAC name is potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide.
| Compound Name | potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide |
|---|---|
| PubChem CID | 169219888 |
| Molecular Formula | C10H12KNO |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide |
| SMILES | CC.Cc1noc2c[c-]ccc12.[K+] |
| InChI | InChI=1S/C8H6NO.C2H6.K/c1-6-7-4-2-3-5-8(7)10-9-6;1-2;/h2,4-5H,1H3;1-2H3;/q-1;;+1 |
| InChIKey | APNICCABCOGGHB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|