About potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide
potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide (PubChem CID 169219888) has the molecular formula C10H12KNO
and a molecular weight of 201.31 g/mol. Its IUPAC name is potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide.
Molecular Properties
| Compound Name | potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide |
| PubChem CID | 169219888 |
| Molecular Formula | C10H12KNO |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide |
| SMILES | CC.Cc1noc2c[c-]ccc12.[K+] |
| InChI | InChI=1S/C8H6NO.C2H6.K/c1-6-7-4-2-3-5-8(7)10-9-6;1-2;/h2,4-5H,1H3;1-2H3;/q-1;;+1 |
| InChIKey | APNICCABCOGGHB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide?
The IUPAC name of potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide (CID 169219888) is potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide.
What is the SMILES notation for potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide?
The canonical SMILES for potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide is CC.Cc1noc2c[c-]ccc12.[K+].
What is the InChIKey of potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide?
The InChIKey is APNICCABCOGGHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6NO.C2H6.K/c1-6-7-4-2-3-5-8(7)10-9-6;1-2;/h2,4-5H,1H3;1-2H3;/q-1;;+1.
What are the key properties of potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide?
potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide has a molecular weight of 201.31 g/mol, XLogP of -0.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethane;3-methyl-6H-1,2-benzoxazol-6-ide is sourced from PubChem (CID 169219888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).