C13H16N2O3 — CID 114265510
2-(1,2-benzoxazol-3-ylamino)-2-methylpentanoic acid (PubChem CID 114265510) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-ylamino)-2-methylpentanoic acid.
| Compound Name | 2-(1,2-benzoxazol-3-ylamino)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 114265510 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-(1,2-benzoxazol-3-ylamino)-2-methylpentanoic acid |
| SMILES | CCCC(C)(Nc1noc2ccccc12)C(=O)O |
| InChI | InChI=1S/C13H16N2O3/c1-3-8-13(2,12(16)17)14-11-9-6-4-5-7-10(9)18-15-11/h4-7H,3,8H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | DNTYKVAPTKHKSE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |