C13H15N3O3S — CID 15983624
ethyl 2-(1,2-benzoxazol-3-ylcarbamothioylamino)propanoate (PubChem CID 15983624) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is ethyl 2-(1,2-benzoxazol-3-ylcarbamothioylamino)propanoate.
| Compound Name | ethyl 2-(1,2-benzoxazol-3-ylcarbamothioylamino)propanoate |
|---|---|
| PubChem CID | 15983624 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | ethyl 2-(1,2-benzoxazol-3-ylcarbamothioylamino)propanoate |
| SMILES | CCOC(=O)C(C)NC(=S)Nc1noc2ccccc12 |
| InChI | InChI=1S/C13H15N3O3S/c1-3-18-12(17)8(2)14-13(20)15-11-9-6-4-5-7-10(9)19-16-11/h4-8H,3H2,1-2H3,(H2,14,15,16,20) |
| InChIKey | VZFMLPWMRLEHIE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|