C11H13N3OS — CID 15983877
1-(1,2-benzoxazol-3-yl)-3-propan-2-ylthiourea (PubChem CID 15983877) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-3-propan-2-ylthiourea.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 15983877 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1noc2ccccc12 |
| InChI | InChI=1S/C11H13N3OS/c1-7(2)12-11(16)13-10-8-5-3-4-6-9(8)15-14-10/h3-7H,1-2H3,(H2,12,13,14,16) |
| InChIKey | IVPURUWZAGBVPO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|