C11H10FN3O3S — CID 160638531
2-[(5-fluoro-1,2-benzoxazol-3-yl)carbamothioylamino]propanoic acid (PubChem CID 160638531) has the molecular formula C11H10FN3O3S and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[(5-fluoro-1,2-benzoxazol-3-yl)carbamothioylamino]propanoic acid.
| Compound Name | 2-[(5-fluoro-1,2-benzoxazol-3-yl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 160638531 |
| Molecular Formula | C11H10FN3O3S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-[(5-fluoro-1,2-benzoxazol-3-yl)carbamothioylamino]propanoic acid |
| SMILES | CC(NC(=S)Nc1noc2ccc(F)cc12)C(=O)O |
| InChI | InChI=1S/C11H10FN3O3S/c1-5(10(16)17)13-11(19)14-9-7-4-6(12)2-3-8(7)18-15-9/h2-5H,1H3,(H,16,17)(H2,13,14,15,19) |
| InChIKey | QYWMAMMFYDUTKY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|