2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid

C13H15F2NO3 — CID 120523631

IUPAC2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid
SMILESCC(NC(=O)CC(C)c1ccc(F)cc1F)C(=O)O
InChIInChI=1S/C13H15F2NO3/c1-7(5-12(17)16-8(2)13(18)19)10-4-3-9(14)6-11(10)15/h3-4,6-8H,5H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyBTVDUWFRSBRSKQ-UHFFFAOYSA-N
MW271.26 g/mol
LogP2.05
Rot. Bonds5

About 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid

2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid (PubChem CID 120523631) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid.

Molecular Properties

Compound Name2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid
PubChem CID120523631
Molecular FormulaC13H15F2NO3
Molecular Weight271.26 g/mol
Exact Mass271.10
IUPAC Name2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid
SMILESCC(NC(=O)CC(C)c1ccc(F)cc1F)C(=O)O
InChIInChI=1S/C13H15F2NO3/c1-7(5-12(17)16-8(2)13(18)19)10-4-3-9(14)6-11(10)15/h3-4,6-8H,5H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyBTVDUWFRSBRSKQ-UHFFFAOYSA-N
XLogP2.05
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.26
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid?
The IUPAC name of 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid (CID 120523631) is 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid.
What is the SMILES notation for 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid?
The canonical SMILES for 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid is CC(NC(=O)CC(C)c1ccc(F)cc1F)C(=O)O.
What is the InChIKey of 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid?
The InChIKey is BTVDUWFRSBRSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO3/c1-7(5-12(17)16-8(2)13(18)19)10-4-3-9(14)6-11(10)15/h3-4,6-8H,5H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid?
2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid has a molecular weight of 271.26 g/mol, XLogP of 2.05, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid is sourced from PubChem (CID 120523631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).