C13H15F2NO3 — CID 120523631
2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid (PubChem CID 120523631) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid.
| Compound Name | 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 120523631 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[3-(2,4-difluorophenyl)butanoylamino]propanoic acid |
| SMILES | CC(NC(=O)CC(C)c1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C13H15F2NO3/c1-7(5-12(17)16-8(2)13(18)19)10-4-3-9(14)6-11(10)15/h3-4,6-8H,5H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | BTVDUWFRSBRSKQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |