C14H8F2N2O2 — CID 11988661
N-(1,2-benzoxazol-3-yl)-2,3-difluorobenzamide (PubChem CID 11988661) has the molecular formula C14H8F2N2O2 and a molecular weight of 274.23 g/mol. Its IUPAC name is N-(1,2-benzoxazol-3-yl)-2,3-difluorobenzamide.
| Compound Name | N-(1,2-benzoxazol-3-yl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 11988661 |
| Molecular Formula | C14H8F2N2O2 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | N-(1,2-benzoxazol-3-yl)-2,3-difluorobenzamide |
| SMILES | O=C(Nc1noc2ccccc12)c1cccc(F)c1F |
| InChI | InChI=1S/C14H8F2N2O2/c15-10-6-3-5-9(12(10)16)14(19)17-13-8-4-1-2-7-11(8)20-18-13/h1-7H,(H,17,18,19) |
| InChIKey | XQDOHFMZOGKJMU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |