C15H10F3N3O2S — CID 87435948
1-(1,2-benzoxazol-3-yl)-3-[4-(trifluoromethyl)phenyl]sulfanylurea (PubChem CID 87435948) has the molecular formula C15H10F3N3O2S and a molecular weight of 353.33 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-3-[4-(trifluoromethyl)phenyl]sulfanylurea.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-3-[4-(trifluoromethyl)phenyl]sulfanylurea |
|---|---|
| PubChem CID | 87435948 |
| Molecular Formula | C15H10F3N3O2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-3-[4-(trifluoromethyl)phenyl]sulfanylurea |
| SMILES | O=C(NSc1ccc(C(F)(F)F)cc1)Nc1noc2ccccc12 |
| InChI | InChI=1S/C15H10F3N3O2S/c16-15(17,18)9-5-7-10(8-6-9)24-21-14(22)19-13-11-3-1-2-4-12(11)23-20-13/h1-8H,(H2,19,20,21,22) |
| InChIKey | MOWFXEZWUZSJMC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|