C16H12F6N2OS — CID 167215326
1-[[3-(trifluoromethyl)phenyl]methyl]-3-[4-(trifluoromethyl)phenyl]sulfanylurea (PubChem CID 167215326) has the molecular formula C16H12F6N2OS and a molecular weight of 394.34 g/mol. Its IUPAC name is 1-[[3-(trifluoromethyl)phenyl]methyl]-3-[4-(trifluoromethyl)phenyl]sulfanylurea.
| Compound Name | 1-[[3-(trifluoromethyl)phenyl]methyl]-3-[4-(trifluoromethyl)phenyl]sulfanylurea |
|---|---|
| PubChem CID | 167215326 |
| Molecular Formula | C16H12F6N2OS |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-[[3-(trifluoromethyl)phenyl]methyl]-3-[4-(trifluoromethyl)phenyl]sulfanylurea |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)NSc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F6N2OS/c17-15(18,19)11-4-6-13(7-5-11)26-24-14(25)23-9-10-2-1-3-12(8-10)16(20,21)22/h1-8H,9H2,(H2,23,24,25) |
| InChIKey | BNSPMQTYROBRBR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|