naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate

C18H12N2O3 — CID 67410130

IUPACnaphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate
SMILESO=C(Nc1noc2ccccc12)Oc1ccc2ccccc2c1
InChIInChI=1S/C18H12N2O3/c21-18(19-17-15-7-3-4-8-16(15)23-20-17)22-14-10-9-12-5-1-2-6-13(12)11-14/h1-11H,(H,19,20,21)
InChIKeyYNEOAIUUODEFPP-UHFFFAOYSA-N
MW304.31 g/mol
LogP4.59
Rot. Bonds2

About naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate

naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate (PubChem CID 67410130) has the molecular formula C18H12N2O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate.

Molecular Properties

Compound Namenaphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate
PubChem CID67410130
Molecular FormulaC18H12N2O3
Molecular Weight304.31 g/mol
Exact Mass304.08
IUPAC Namenaphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate
SMILESO=C(Nc1noc2ccccc12)Oc1ccc2ccccc2c1
InChIInChI=1S/C18H12N2O3/c21-18(19-17-15-7-3-4-8-16(15)23-20-17)22-14-10-9-12-5-1-2-6-13(12)11-14/h1-11H,(H,19,20,21)
InChIKeyYNEOAIUUODEFPP-UHFFFAOYSA-N
XLogP4.59
TPSA64.36 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.31
LogP ≤ 54.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate?
The IUPAC name of naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate (CID 67410130) is naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate.
What is the SMILES notation for naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate?
The canonical SMILES for naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate is O=C(Nc1noc2ccccc12)Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate?
The InChIKey is YNEOAIUUODEFPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O3/c21-18(19-17-15-7-3-4-8-16(15)23-20-17)22-14-10-9-12-5-1-2-6-13(12)11-14/h1-11H,(H,19,20,21).
What are the key properties of naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate?
naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate has a molecular weight of 304.31 g/mol, XLogP of 4.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl N-(1,2-benzoxazol-3-yl)carbamate is sourced from PubChem (CID 67410130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).