C10H8Cl3N3O3 — CID 174624892
2,2,2-trichloroethyl N-(1,2-benzoxazol-3-ylamino)carbamate (PubChem CID 174624892) has the molecular formula C10H8Cl3N3O3 and a molecular weight of 324.55 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(1,2-benzoxazol-3-ylamino)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(1,2-benzoxazol-3-ylamino)carbamate |
|---|---|
| PubChem CID | 174624892 |
| Molecular Formula | C10H8Cl3N3O3 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 2,2,2-trichloroethyl N-(1,2-benzoxazol-3-ylamino)carbamate |
| SMILES | O=C(NNc1noc2ccccc12)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H8Cl3N3O3/c11-10(12,13)5-18-9(17)15-14-8-6-3-1-2-4-7(6)19-16-8/h1-4H,5H2,(H,14,16)(H,15,17) |
| InChIKey | DWEMTANZAANJNH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|