C16H10N2O3S — CID 67407286
1-benzothiophen-3-yl N-(1,2-benzoxazol-3-yl)carbamate (PubChem CID 67407286) has the molecular formula C16H10N2O3S and a molecular weight of 310.33 g/mol. Its IUPAC name is 1-benzothiophen-3-yl N-(1,2-benzoxazol-3-yl)carbamate.
| Compound Name | 1-benzothiophen-3-yl N-(1,2-benzoxazol-3-yl)carbamate |
|---|---|
| PubChem CID | 67407286 |
| Molecular Formula | C16H10N2O3S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 1-benzothiophen-3-yl N-(1,2-benzoxazol-3-yl)carbamate |
| SMILES | O=C(Nc1noc2ccccc12)Oc1csc2ccccc12 |
| InChI | InChI=1S/C16H10N2O3S/c19-16(17-15-11-6-1-3-7-12(11)21-18-15)20-13-9-22-14-8-4-2-5-10(13)14/h1-9H,(H,17,18,19) |
| InChIKey | JYJXSSUUGGWPRH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |