C16H8Cl4F2N2O3 — CID 171548166
2,2,2-trichloroethyl N-[6-chloro-4-(2,6-difluorophenyl)-1,2-benzoxazol-3-yl]carbamate (PubChem CID 171548166) has the molecular formula C16H8Cl4F2N2O3 and a molecular weight of 456.06 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[6-chloro-4-(2,6-difluorophenyl)-1,2-benzoxazol-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[6-chloro-4-(2,6-difluorophenyl)-1,2-benzoxazol-3-yl]carbamate |
|---|---|
| PubChem CID | 171548166 |
| Molecular Formula | C16H8Cl4F2N2O3 |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | 2,2,2-trichloroethyl N-[6-chloro-4-(2,6-difluorophenyl)-1,2-benzoxazol-3-yl]carbamate |
| SMILES | O=C(Nc1noc2cc(Cl)cc(-c3c(F)cccc3F)c12)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H8Cl4F2N2O3/c17-7-4-8(12-9(21)2-1-3-10(12)22)13-11(5-7)27-24-14(13)23-15(25)26-6-16(18,19)20/h1-5H,6H2,(H,23,24,25) |
| InChIKey | ZAAOSDYJOHHHGE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|