C11H12N2O2 — CID 18378943
4-(1,2-benzoxazol-3-ylamino)butanal (PubChem CID 18378943) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-(1,2-benzoxazol-3-ylamino)butanal.
| Compound Name | 4-(1,2-benzoxazol-3-ylamino)butanal |
|---|---|
| PubChem CID | 18378943 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-(1,2-benzoxazol-3-ylamino)butanal |
| SMILES | O=CCCCNc1noc2ccccc12 |
| InChI | InChI=1S/C11H12N2O2/c14-8-4-3-7-12-11-9-5-1-2-6-10(9)15-13-11/h1-2,5-6,8H,3-4,7H2,(H,12,13) |
| InChIKey | HCYYNOMHOYLQRD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|