C9H10FN3O — CID 84665921
N'-(6-fluoro-1,2-benzoxazol-3-yl)ethane-1,2-diamine (PubChem CID 84665921) has the molecular formula C9H10FN3O and a molecular weight of 195.20 g/mol. Its IUPAC name is N'-(6-fluoro-1,2-benzoxazol-3-yl)ethane-1,2-diamine.
| Compound Name | N'-(6-fluoro-1,2-benzoxazol-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 84665921 |
| Molecular Formula | C9H10FN3O |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | N'-(6-fluoro-1,2-benzoxazol-3-yl)ethane-1,2-diamine |
| SMILES | NCCNc1noc2cc(F)ccc12 |
| InChI | InChI=1S/C9H10FN3O/c10-6-1-2-7-8(5-6)14-13-9(7)12-4-3-11/h1-2,5H,3-4,11H2,(H,12,13) |
| InChIKey | KTVMDTDUEOEIIU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |