C10H12FN3O — CID 83834388
N'-(5-fluoro-1,2-benzoxazol-3-yl)propane-1,3-diamine (PubChem CID 83834388) has the molecular formula C10H12FN3O and a molecular weight of 209.22 g/mol. Its IUPAC name is N'-(5-fluoro-1,2-benzoxazol-3-yl)propane-1,3-diamine.
| Compound Name | N'-(5-fluoro-1,2-benzoxazol-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 83834388 |
| Molecular Formula | C10H12FN3O |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N'-(5-fluoro-1,2-benzoxazol-3-yl)propane-1,3-diamine |
| SMILES | NCCCNc1noc2ccc(F)cc12 |
| InChI | InChI=1S/C10H12FN3O/c11-7-2-3-9-8(6-7)10(14-15-9)13-5-1-4-12/h2-3,6H,1,4-5,12H2,(H,13,14) |
| InChIKey | LJZWNGLBEHRCKF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|