C11H13FN2O — CID 114732622
N'-(5-fluoro-1-benzofuran-2-yl)propane-1,3-diamine (PubChem CID 114732622) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is N'-(5-fluoro-1-benzofuran-2-yl)propane-1,3-diamine.
| Compound Name | N'-(5-fluoro-1-benzofuran-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114732622 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N'-(5-fluoro-1-benzofuran-2-yl)propane-1,3-diamine |
| SMILES | NCCCNc1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C11H13FN2O/c12-9-2-3-10-8(6-9)7-11(15-10)14-5-1-4-13/h2-3,6-7,14H,1,4-5,13H2 |
| InChIKey | RZIBUYNSRCAWJO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|