C12H16N2O — CID 114732599
N'-(5-methyl-1-benzofuran-2-yl)propane-1,3-diamine (PubChem CID 114732599) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N'-(5-methyl-1-benzofuran-2-yl)propane-1,3-diamine.
| Compound Name | N'-(5-methyl-1-benzofuran-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114732599 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N'-(5-methyl-1-benzofuran-2-yl)propane-1,3-diamine |
| SMILES | Cc1ccc2oc(NCCCN)cc2c1 |
| InChI | InChI=1S/C12H16N2O/c1-9-3-4-11-10(7-9)8-12(15-11)14-6-2-5-13/h3-4,7-8,14H,2,5-6,13H2,1H3 |
| InChIKey | UEBUKZOAKXKTEB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|