C10H11NO — CID 123740126
N,5-dimethyl-1-benzofuran-2-amine (PubChem CID 123740126) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is N,5-dimethyl-1-benzofuran-2-amine.
| Compound Name | N,5-dimethyl-1-benzofuran-2-amine |
|---|---|
| PubChem CID | 123740126 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | N,5-dimethyl-1-benzofuran-2-amine |
| SMILES | CNc1cc2cc(C)ccc2o1 |
| InChI | InChI=1S/C10H11NO/c1-7-3-4-9-8(5-7)6-10(11-2)12-9/h3-6,11H,1-2H3 |
| InChIKey | CHYSIYXFOLBVQP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |