C15H14ClN3O — CID 152669842
6-chloro-N-(3-pyridin-4-ylpropyl)-1,2-benzoxazol-3-amine (PubChem CID 152669842) has the molecular formula C15H14ClN3O and a molecular weight of 287.75 g/mol. Its IUPAC name is 6-chloro-N-(3-pyridin-4-ylpropyl)-1,2-benzoxazol-3-amine.
| Compound Name | 6-chloro-N-(3-pyridin-4-ylpropyl)-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 152669842 |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 6-chloro-N-(3-pyridin-4-ylpropyl)-1,2-benzoxazol-3-amine |
| SMILES | Clc1ccc2c(NCCCc3ccncc3)noc2c1 |
| InChI | InChI=1S/C15H14ClN3O/c16-12-3-4-13-14(10-12)20-19-15(13)18-7-1-2-11-5-8-17-9-6-11/h3-6,8-10H,1-2,7H2,(H,18,19) |
| InChIKey | ZLHHLNCNGVBJDT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|