C12H8ClN3O — CID 15870137
6-chloro-N-pyridin-4-yl-1,2-benzoxazol-3-amine (PubChem CID 15870137) has the molecular formula C12H8ClN3O and a molecular weight of 245.67 g/mol. Its IUPAC name is 6-chloro-N-pyridin-4-yl-1,2-benzoxazol-3-amine.
| Compound Name | 6-chloro-N-pyridin-4-yl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 15870137 |
| Molecular Formula | C12H8ClN3O |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 6-chloro-N-pyridin-4-yl-1,2-benzoxazol-3-amine |
| SMILES | Clc1ccc2c(Nc3ccncc3)noc2c1 |
| InChI | InChI=1S/C12H8ClN3O/c13-8-1-2-10-11(7-8)17-16-12(10)15-9-3-5-14-6-4-9/h1-7H,(H,14,15,16) |
| InChIKey | SVEIGHOTYPYZQS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |