C19H18ClN3O5 — CID 70264594
(Z)-but-2-enedioic acid;6-chloro-N-propyl-N-pyridin-4-yl-1,2-benzoxazol-3-amine (PubChem CID 70264594) has the molecular formula C19H18ClN3O5 and a molecular weight of 403.82 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;6-chloro-N-propyl-N-pyridin-4-yl-1,2-benzoxazol-3-amine.
| Compound Name | (Z)-but-2-enedioic acid;6-chloro-N-propyl-N-pyridin-4-yl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 70264594 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (Z)-but-2-enedioic acid;6-chloro-N-propyl-N-pyridin-4-yl-1,2-benzoxazol-3-amine |
| SMILES | CCCN(c1ccncc1)c1noc2cc(Cl)ccc12.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H14ClN3O.C4H4O4/c1-2-9-19(12-5-7-17-8-6-12)15-13-4-3-11(16)10-14(13)20-18-15;5-3(6)1-2-4(7)8/h3-8,10H,2,9H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GSGCCMWUSLIQOZ-BTJKTKAUSA-N |
| XLogP | 4.14 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|