C21H23N3O4 — CID 70145577
(Z)-but-2-enedioic acid;3-methyl-N-propyl-N-pyridin-4-ylindol-1-amine (PubChem CID 70145577) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-methyl-N-propyl-N-pyridin-4-ylindol-1-amine.
| Compound Name | (Z)-but-2-enedioic acid;3-methyl-N-propyl-N-pyridin-4-ylindol-1-amine |
|---|---|
| PubChem CID | 70145577 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-methyl-N-propyl-N-pyridin-4-ylindol-1-amine |
| SMILES | CCCN(c1ccncc1)n1cc(C)c2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H19N3.C4H4O4/c1-3-12-19(15-8-10-18-11-9-15)20-13-14(2)16-6-4-5-7-17(16)20;5-3(6)1-2-4(7)8/h4-11,13H,3,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | VOFYUOXJFNBVTL-BTJKTKAUSA-N |
| XLogP | 3.74 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|