C24H21N3O4 — CID 14536465
(Z)-but-2-enedioic acid;N-prop-2-enyl-N-pyridin-4-ylcarbazol-9-amine (PubChem CID 14536465) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-prop-2-enyl-N-pyridin-4-ylcarbazol-9-amine.
| Compound Name | (Z)-but-2-enedioic acid;N-prop-2-enyl-N-pyridin-4-ylcarbazol-9-amine |
|---|---|
| PubChem CID | 14536465 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-prop-2-enyl-N-pyridin-4-ylcarbazol-9-amine |
| SMILES | C=CCN(c1ccncc1)n1c2ccccc2c2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H17N3.C4H4O4/c1-2-15-22(16-11-13-21-14-12-16)23-19-9-5-3-7-17(19)18-8-4-6-10-20(18)23;5-3(6)1-2-4(7)8/h2-14H,1,15H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | QTQSJMVNOBOHAP-BTJKTKAUSA-N |
| XLogP | 4.36 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|