C20H17Cl2N5 — CID 22741956
1-N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazine-1,7-diamine;hydrochloride (PubChem CID 22741956) has the molecular formula C20H17Cl2N5 and a molecular weight of 398.30 g/mol. Its IUPAC name is 1-N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazine-1,7-diamine;hydrochloride.
| Compound Name | 1-N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazine-1,7-diamine;hydrochloride |
|---|---|
| PubChem CID | 22741956 |
| Molecular Formula | C20H17Cl2N5 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazine-1,7-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc2c(Cc3ccncc3)nnc(Nc3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C20H16ClN5.ClH/c21-14-1-4-16(5-2-14)24-20-18-12-15(22)3-6-17(18)19(25-26-20)11-13-7-9-23-10-8-13;/h1-10,12H,11,22H2,(H,24,26);1H |
| InChIKey | NFLFRCUYZZTFHD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|