C21H19ClN4O3S — CID 71584923
N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;methanesulfonic acid (PubChem CID 71584923) has the molecular formula C21H19ClN4O3S and a molecular weight of 442.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;methanesulfonic acid.
| Compound Name | N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;methanesulfonic acid |
|---|---|
| PubChem CID | 71584923 |
| Molecular Formula | C21H19ClN4O3S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Clc1ccc(Nc2nnc(Cc3ccncc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H15ClN4.CH4O3S/c21-15-5-7-16(8-6-15)23-20-18-4-2-1-3-17(18)19(24-25-20)13-14-9-11-22-12-10-14;1-5(2,3)4/h1-12H,13H2,(H,23,25);1H3,(H,2,3,4) |
| InChIKey | YDWDLHUGMPTBKF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|